C18H26FN7O — CID 111701051
N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111701051) has the molecular formula C18H26FN7O and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111701051 |
| Molecular Formula | C18H26FN7O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H26FN7O/c1-4-16-25-24-12-26(16)10-9-23-18(20-3)22-8-7-21-17(27)14-6-5-13(2)15(19)11-14/h5-6,11-12H,4,7-10H2,1-3H3,(H,21,27)(H2,20,22,23) |
| InChIKey | NPIYUOYBTQXYPK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|