C15H24N8OS — CID 111700939
N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111700939) has the molecular formula C15H24N8OS and a molecular weight of 364.48 g/mol. Its IUPAC name is N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111700939 |
| Molecular Formula | C15H24N8OS |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C15H24N8OS/c1-4-12-22-21-9-23(12)8-7-19-15(16-3)18-6-5-17-14(24)13-11(2)20-10-25-13/h9-10H,4-8H2,1-3H3,(H,17,24)(H2,16,18,19) |
| InChIKey | FSRBXQBEICQDOU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|