C17H25BrIN7O — CID 111700190
N-(5-bromo-2-methylphenyl)-2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111700190) has the molecular formula C17H25BrIN7O and a molecular weight of 550.24 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111700190 |
| Molecular Formula | C17H25BrIN7O |
| Molecular Weight | 550.24 g/mol |
| Exact Mass | 549.03 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCC(=O)Nc1cc(Br)ccc1C.I |
| InChI | InChI=1S/C17H24BrN7O.HI/c1-4-15-24-22-11-25(15)8-7-20-17(19-3)21-10-16(26)23-14-9-13(18)6-5-12(14)2;/h5-6,9,11H,4,7-8,10H2,1-3H3,(H,23,26)(H2,19,20,21);1H |
| InChIKey | GDPVWCMVEQSTPB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|