C15H22BrN5O2 — CID 119132968
N-(5-bromo-2-methylphenyl)-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 119132968) has the molecular formula C15H22BrN5O2 and a molecular weight of 384.28 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119132968 |
| Molecular Formula | C15H22BrN5O2 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCC(=O)Nc1cc(Br)ccc1C)NCC(=O)N(C)C |
| InChI | InChI=1S/C15H22BrN5O2/c1-10-5-6-11(16)7-12(10)20-13(22)8-18-15(17-2)19-9-14(23)21(3)4/h5-7H,8-9H2,1-4H3,(H,20,22)(H2,17,18,19) |
| InChIKey | USEOHXKZXUHPKB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|