C18H20BrF2IN4O — CID 111902116
N-(5-bromo-2-methylphenyl)-2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111902116) has the molecular formula C18H20BrF2IN4O and a molecular weight of 553.19 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111902116 |
| Molecular Formula | C18H20BrF2IN4O |
| Molecular Weight | 553.19 g/mol |
| Exact Mass | 551.98 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1cc(Br)ccc1C)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C18H19BrF2N4O.HI/c1-11-3-4-13(19)8-16(11)25-17(26)10-24-18(22-2)23-9-12-7-14(20)5-6-15(12)21;/h3-8H,9-10H2,1-2H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | WMZQMCNUSSTPFH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|