C21H25BrN4O2 — CID 111563266
N-(5-bromo-2-methylphenyl)-2-[[N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111563266) has the molecular formula C21H25BrN4O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111563266 |
| Molecular Formula | C21H25BrN4O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)CCO2)NCC(=O)Nc1cc(Br)ccc1C |
| InChI | InChI=1S/C21H25BrN4O2/c1-14-3-5-17(22)12-18(14)26-20(27)13-25-21(23-2)24-9-7-15-4-6-19-16(11-15)8-10-28-19/h3-6,11-12H,7-10,13H2,1-2H3,(H,26,27)(H2,23,24,25) |
| InChIKey | RYRQRRPJSGPNFE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|