C20H24FN3O — CID 111562226
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine (PubChem CID 111562226) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111562226 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)CCO2)NCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C20H24FN3O/c1-14-11-16(3-5-18(14)21)13-24-20(22-2)23-9-7-15-4-6-19-17(12-15)8-10-25-19/h3-6,11-12H,7-10,13H2,1-2H3,(H2,22,23,24) |
| InChIKey | NIMKWCIYLHKVLB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|