C20H26BrIN4O2 — CID 109409265
N-(5-bromo-2-methylphenyl)-2-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 109409265) has the molecular formula C20H26BrIN4O2 and a molecular weight of 561.26 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109409265 |
| Molecular Formula | C20H26BrIN4O2 |
| Molecular Weight | 561.26 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1cc(Br)ccc1C)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C20H25BrN4O2.HI/c1-14-8-9-17(21)10-18(14)25-19(27)12-24-20(22-2)23-11-16(13-26)15-6-4-3-5-7-15;/h3-10,16,26H,11-13H2,1-2H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | CDXLZYYXJBDMSD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|