C19H24BrN3O2 — CID 109410043
1-[2-(3-bromophenoxy)ethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine (PubChem CID 109410043) has the molecular formula C19H24BrN3O2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109410043 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCOc1cccc(Br)c1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C19H24BrN3O2/c1-21-19(22-10-11-25-18-9-5-8-17(20)12-18)23-13-16(14-24)15-6-3-2-4-7-15/h2-9,12,16,24H,10-11,13-14H2,1H3,(H2,21,22,23) |
| InChIKey | FUGFEWJEQGQRKF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|