C16H19BrN4O — CID 110969100
1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110969100) has the molecular formula C16H19BrN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110969100 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCOc1cccc(Br)c1)NCc1ccccn1 |
| InChI | InChI=1S/C16H19BrN4O/c1-18-16(21-12-14-6-2-3-8-19-14)20-9-10-22-15-7-4-5-13(17)11-15/h2-8,11H,9-10,12H2,1H3,(H2,18,20,21) |
| InChIKey | GFRJLSXYCWHXMF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|