C17H25BrIN5O — CID 111951680
1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951680) has the molecular formula C17H25BrIN5O and a molecular weight of 522.23 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951680 |
| Molecular Formula | C17H25BrIN5O |
| Molecular Weight | 522.23 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc(Br)c1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C17H24BrN5O.HI/c1-12-16(13(2)23(4)22-12)11-21-17(19-3)20-8-9-24-15-7-5-6-14(18)10-15;/h5-7,10H,8-9,11H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | JOIBCBWRELZOEB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|