C23H24IN5OS — CID 111980608
2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111980608) has the molecular formula C23H24IN5OS and a molecular weight of 545.45 g/mol. Its IUPAC name is 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111980608 |
| Molecular Formula | C23H24IN5OS |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(-c2ccccc2)n1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C23H23N5OS.HI/c1-24-23(26-14-20-15-29-21(27-20)17-8-4-2-5-9-17)25-13-12-19-16-30-22(28-19)18-10-6-3-7-11-18;/h2-11,15-16H,12-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | BAQIGVJTXHQQDH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|