C18H22IN5OS — CID 111981202
1-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111981202) has the molecular formula C18H22IN5OS and a molecular weight of 483.38 g/mol. Its IUPAC name is 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981202 |
| Molecular Formula | C18H22IN5OS |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 1-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1nc(CN/C(=N\C)NCc2coc(-c3ccccc3)n2)cs1.I |
| InChI | InChI=1S/C18H21N5OS.HI/c1-3-16-22-15(12-25-16)10-21-18(19-2)20-9-14-11-24-17(23-14)13-7-5-4-6-8-13;/h4-8,11-12H,3,9-10H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | JCYYMAIEKHVPTA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|