C19H23NO3S — CID 148689231
2-[2-oxo-3-(2-phenyl-1,3-thiazol-4-yl)propyl]heptanoic acid (PubChem CID 148689231) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[2-oxo-3-(2-phenyl-1,3-thiazol-4-yl)propyl]heptanoic acid.
| Compound Name | 2-[2-oxo-3-(2-phenyl-1,3-thiazol-4-yl)propyl]heptanoic acid |
|---|---|
| PubChem CID | 148689231 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[2-oxo-3-(2-phenyl-1,3-thiazol-4-yl)propyl]heptanoic acid |
| SMILES | CCCCCC(CC(=O)Cc1csc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C19H23NO3S/c1-2-3-5-10-15(19(22)23)11-17(21)12-16-13-24-18(20-16)14-8-6-4-7-9-14/h4,6-9,13,15H,2-3,5,10-12H2,1H3,(H,22,23) |
| InChIKey | NTCXYKYWZYOIMS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|