C20H15F2NO3S — CID 161460814
2-(2,5-difluorophenyl)-4-oxo-5-(2-phenyl-1,3-thiazol-4-yl)pentanoic acid (PubChem CID 161460814) has the molecular formula C20H15F2NO3S and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-4-oxo-5-(2-phenyl-1,3-thiazol-4-yl)pentanoic acid.
| Compound Name | 2-(2,5-difluorophenyl)-4-oxo-5-(2-phenyl-1,3-thiazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 161460814 |
| Molecular Formula | C20H15F2NO3S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-(2,5-difluorophenyl)-4-oxo-5-(2-phenyl-1,3-thiazol-4-yl)pentanoic acid |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)CC(C(=O)O)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H15F2NO3S/c21-13-6-7-18(22)16(8-13)17(20(25)26)10-15(24)9-14-11-27-19(23-14)12-4-2-1-3-5-12/h1-8,11,17H,9-10H2,(H,25,26) |
| InChIKey | WBTYJKQOZGJSMG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |