C15H15FN2O3S — CID 119223235
2-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]butanoic acid (PubChem CID 119223235) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119223235 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)Cc1csc(-c2cccc(F)c2)n1)C(=O)O |
| InChI | InChI=1S/C15H15FN2O3S/c1-2-12(15(20)21)18-13(19)7-11-8-22-14(17-11)9-4-3-5-10(16)6-9/h3-6,8,12H,2,7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | KGFAUWYBDMICOF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |