C18H23FN2OS — CID 36617877
2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-[(2R)-heptan-2-yl]acetamide (PubChem CID 36617877) has the molecular formula C18H23FN2OS and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-[(2R)-heptan-2-yl]acetamide.
| Compound Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-[(2R)-heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 36617877 |
| Molecular Formula | C18H23FN2OS |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-[(2R)-heptan-2-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)Cc1csc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H23FN2OS/c1-3-4-5-7-13(2)20-17(22)11-16-12-23-18(21-16)14-8-6-9-15(19)10-14/h6,8-10,12-13H,3-5,7,11H2,1-2H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | NVOCKRGNCORKAK-CYBMUJFWSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|