C18H20ClN3O4S — CID 146852082
(2S)-2-[3-(carbamoylamino)propyl]-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid (PubChem CID 146852082) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is (2S)-2-[3-(carbamoylamino)propyl]-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid.
| Compound Name | (2S)-2-[3-(carbamoylamino)propyl]-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 146852082 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (2S)-2-[3-(carbamoylamino)propyl]-5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid |
| SMILES | NC(=O)NCCC[C@@H](CC(=O)Cc1csc(-c2ccccc2Cl)n1)C(=O)O |
| InChI | InChI=1S/C18H20ClN3O4S/c19-15-6-2-1-5-14(15)16-22-12(10-27-16)9-13(23)8-11(17(24)25)4-3-7-21-18(20)26/h1-2,5-6,10-11H,3-4,7-9H2,(H,24,25)(H3,20,21,26)/t11-/m0/s1 |
| InChIKey | SIWCVITYJZLJMR-NSHDSACASA-N |
| XLogP | 3.11 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|