C16H16ClNO3S — CID 161099484
5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-ethyl-4-oxopentanoic acid (PubChem CID 161099484) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-ethyl-4-oxopentanoic acid.
| Compound Name | 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-ethyl-4-oxopentanoic acid |
|---|---|
| PubChem CID | 161099484 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-2-ethyl-4-oxopentanoic acid |
| SMILES | CCC(CC(=O)Cc1csc(-c2ccccc2Cl)n1)C(=O)O |
| InChI | InChI=1S/C16H16ClNO3S/c1-2-10(16(20)21)7-12(19)8-11-9-22-15(18-11)13-5-3-4-6-14(13)17/h3-6,9-10H,2,7-8H2,1H3,(H,20,21) |
| InChIKey | UIFSBTGZNLNVCQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |