C28H33N3O2 — CID 67269121
1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea (PubChem CID 67269121) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea.
| Compound Name | 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea |
|---|---|
| PubChem CID | 67269121 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)NCc1ccccc1)c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C28H33N3O2/c1-2-25(32)16-10-5-11-17-26(31-28(33)30-21-22-12-6-3-7-13-22)27-20-24(18-19-29-27)23-14-8-4-9-15-23/h3-4,6-9,12-15,18-20,26H,2,5,10-11,16-17,21H2,1H3,(H2,30,31,33)/t26-/m0/s1 |
| InChIKey | AMOFOARLEFPWLZ-SANMLTNESA-N |
| XLogP | 6.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|