C32H39F6N3O6 — CID 171932109
N-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]-1-azabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171932109) has the molecular formula C32H39F6N3O6 and a molecular weight of 675.67 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]-1-azabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]-1-azabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171932109 |
| Molecular Formula | C32H39F6N3O6 |
| Molecular Weight | 675.67 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | N-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]-1-azabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C12CCN(CC1)CC2)c1cc(-c2ccccc2)ccn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H37N3O2.2C2HF3O2/c1-2-24(32)11-7-4-8-12-25(30-27(33)28-14-18-31(19-15-28)20-16-28)26-21-23(13-17-29-26)22-9-5-3-6-10-22;2*3-2(4,5)1(6)7/h3,5-6,9-10,13,17,21,25H,2,4,7-8,11-12,14-16,18-20H2,1H3,(H,30,33);2*(H,6,7)/t25-;;/m0../s1 |
| InChIKey | WHJPJMLXCZCNPH-WLOLSGMKSA-N |
| XLogP | 6.59 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|