C37H46F3N5O3 — CID 166626451
tert-butyl N-[(E,1R)-1-(4-fluorophenyl)-4,4-bis[(5-fluoro-2-pyridinyl)methyl]-5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pent-2-enyl]carbamate (PubChem CID 166626451) has the molecular formula C37H46F3N5O3 and a molecular weight of 665.80 g/mol. Its IUPAC name is tert-butyl N-[(E,1R)-1-(4-fluorophenyl)-4,4-bis[(5-fluoro-2-pyridinyl)methyl]-5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1R)-1-(4-fluorophenyl)-4,4-bis[(5-fluoro-2-pyridinyl)methyl]-5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pent-2-enyl]carbamate |
|---|---|
| PubChem CID | 166626451 |
| Molecular Formula | C37H46F3N5O3 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.36 |
| IUPAC Name | tert-butyl N-[(E,1R)-1-(4-fluorophenyl)-4,4-bis[(5-fluoro-2-pyridinyl)methyl]-5-oxo-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pent-2-enyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)C(/C=C/[C@@H](NC(=O)OC(C)(C)C)c2ccc(F)cc2)(Cc2ccc(F)cn2)Cc2ccc(F)cn2)CC(C)(C)N1 |
| InChI | InChI=1S/C37H46F3N5O3/c1-34(2,3)48-33(47)44-31(24-8-10-25(38)11-9-24)16-17-37(20-28-14-12-26(39)22-41-28,21-29-15-13-27(40)23-42-29)32(46)43-30-18-35(4,5)45-36(6,7)19-30/h8-17,22-23,30-31,45H,18-21H2,1-7H3,(H,43,46)(H,44,47)/b17-16+/t31-/m1/s1 |
| InChIKey | MVYHVJILAHGJOS-ZSEBPXDSSA-N |
| XLogP | 6.91 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|