C19H29FN2O3 — CID 22959070
tert-butyl N-[2-[di(propan-2-yl)amino]-1-(4-fluorophenyl)-2-oxoethyl]carbamate (PubChem CID 22959070) has the molecular formula C19H29FN2O3 and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl N-[2-[di(propan-2-yl)amino]-1-(4-fluorophenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[di(propan-2-yl)amino]-1-(4-fluorophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 22959070 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-[2-[di(propan-2-yl)amino]-1-(4-fluorophenyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)N(C(=O)C(NC(=O)OC(C)(C)C)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C19H29FN2O3/c1-12(2)22(13(3)4)17(23)16(14-8-10-15(20)11-9-14)21-18(24)25-19(5,6)7/h8-13,16H,1-7H3,(H,21,24) |
| InChIKey | BEQYAETUPYDWAA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |