C17H34N4O2S — CID 84556059
tert-butyl N-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioylamino]ethyl]carbamate (PubChem CID 84556059) has the molecular formula C17H34N4O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84556059 |
| Molecular Formula | C17H34N4O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | tert-butyl N-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioylamino]ethyl]carbamate |
| SMILES | CC1(C)CC(NC(=S)NCCNC(=O)OC(C)(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C17H34N4O2S/c1-15(2,3)23-14(22)19-9-8-18-13(24)20-12-10-16(4,5)21-17(6,7)11-12/h12,21H,8-11H2,1-7H3,(H,19,22)(H2,18,20,24) |
| InChIKey | RBGMIFLQJIKTES-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|