C18H35N3O3S — CID 84557367
tert-butyl N-[2-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]sulfanylethyl]carbamate (PubChem CID 84557367) has the molecular formula C18H35N3O3S and a molecular weight of 373.56 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84557367 |
| Molecular Formula | C18H35N3O3S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]sulfanylethyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)CSCCNC(=O)OC(C)(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C18H35N3O3S/c1-16(2,3)24-15(23)19-8-9-25-12-14(22)20-13-10-17(4,5)21-18(6,7)11-13/h13,21H,8-12H2,1-7H3,(H,19,23)(H,20,22) |
| InChIKey | BPWHPMMXVBIFCJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|