C14H26N2O5S — CID 84557365
3-methyl-2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]acetyl]amino]butanoic acid (PubChem CID 84557365) has the molecular formula C14H26N2O5S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-methyl-2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 84557365 |
| Molecular Formula | C14H26N2O5S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-methyl-2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CSCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H26N2O5S/c1-9(2)11(12(18)19)16-10(17)8-22-7-6-15-13(20)21-14(3,4)5/h9,11H,6-8H2,1-5H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | HCYMWUNZFJSVIV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|