C13H25N3O5 — CID 108864378
3-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]butanoic acid (PubChem CID 108864378) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 108864378 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)NCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-8(2)9(10(17)18)16-11(19)14-6-7-15-12(20)21-13(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,20)(H,17,18)(H2,14,16,19) |
| InChIKey | NAFVEXGDOMQIEG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|