C17H32N2O2 — CID 59878982
tert-butyl (E)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate (PubChem CID 59878982) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is tert-butyl (E)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate.
| Compound Name | tert-butyl (E)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 59878982 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl (E)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
| SMILES | C/C(=C\C(=O)OC(C)(C)C)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H32N2O2/c1-12(9-14(20)21-15(2,3)4)18-13-10-16(5,6)19-17(7,8)11-13/h9,13,18-19H,10-11H2,1-8H3/b12-9+ |
| InChIKey | NKPSXMXLFSLNKM-FMIVXFBMSA-N |
| XLogP | 3.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|