C15H34N2O — CID 178170769
ethane;N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 178170769) has the molecular formula C15H34N2O and a molecular weight of 258.45 g/mol. Its IUPAC name is ethane;N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | ethane;N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 178170769 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | ethane;N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC.CC.CC(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2O.2C2H6/c1-8(14)12-9-6-10(2,3)13-11(4,5)7-9;2*1-2/h9,13H,6-7H2,1-5H3,(H,12,14);2*1-2H3 |
| InChIKey | CHIAJGCEVFBXCF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |