C15H30N2O — CID 59345639
2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide (PubChem CID 59345639) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide.
| Compound Name | 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 59345639 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
| SMILES | CCC(C)(C)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O/c1-8-13(2,3)12(18)16-11-9-14(4,5)17-15(6,7)10-11/h11,17H,8-10H2,1-7H3,(H,16,18) |
| InChIKey | VCGIPSGOGZMSMB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |