C21H42N4O — CID 142680807
3-[(2,2-dimethylpiperidin-4-yl)amino]-2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 142680807) has the molecular formula C21H42N4O and a molecular weight of 366.59 g/mol. Its IUPAC name is 3-[(2,2-dimethylpiperidin-4-yl)amino]-2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 3-[(2,2-dimethylpiperidin-4-yl)amino]-2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 142680807 |
| Molecular Formula | C21H42N4O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | 3-[(2,2-dimethylpiperidin-4-yl)amino]-2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | CC1(C)CC(NCC(C)(C)C(=O)NC2CC(C)(C)NC(C)(C)C2)CCN1 |
| InChI | InChI=1S/C21H42N4O/c1-18(2,14-22-15-9-10-23-19(3,4)11-15)17(26)24-16-12-20(5,6)25-21(7,8)13-16/h15-16,22-23,25H,9-14H2,1-8H3,(H,24,26) |
| InChIKey | KCWHGYVURSJVQV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |