C15H29N3O2 — CID 108506843
N'-tert-butyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108506843) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-tert-butyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108506843 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N'-tert-butyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H29N3O2/c1-13(2,3)17-12(20)11(19)16-10-8-14(4,5)18-15(6,7)9-10/h10,18H,8-9H2,1-7H3,(H,16,19)(H,17,20) |
| InChIKey | PTRKLYGIRCRJQR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|