C17H34N4O2 — CID 108522161
N-[2-(diethylamino)ethyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108522161) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108522161 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H34N4O2/c1-7-21(8-2)10-9-18-14(22)15(23)19-13-11-16(3,4)20-17(5,6)12-13/h13,20H,7-12H2,1-6H3,(H,18,22)(H,19,23) |
| InChIKey | JQCDMCFJGIWYAR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|