C16H31N3O3 — CID 108522419
N-(5-hydroxypentyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108522419) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-(5-hydroxypentyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108522419 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)NCCCCCO)CC(C)(C)N1 |
| InChI | InChI=1S/C16H31N3O3/c1-15(2)10-12(11-16(3,4)19-15)18-14(22)13(21)17-8-6-5-7-9-20/h12,19-20H,5-11H2,1-4H3,(H,17,21)(H,18,22) |
| InChIKey | UUVQISPTXVYZRB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|