C17H35N3O2 — CID 111120796
1-(2-hydroxyethyl)-1-pentyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 111120796) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-pentyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-(2-hydroxyethyl)-1-pentyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 111120796 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-pentyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CCCCCN(CCO)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H35N3O2/c1-6-7-8-9-20(10-11-21)15(22)18-14-12-16(2,3)19-17(4,5)13-14/h14,19,21H,6-13H2,1-5H3,(H,18,22) |
| InChIKey | TXYQXLKFPQUEEN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|