C38H74N4O2 — CID 18998994
N-[6-[heptanoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)heptanamide (PubChem CID 18998994) has the molecular formula C38H74N4O2 and a molecular weight of 619.04 g/mol. Its IUPAC name is N-[6-[heptanoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)heptanamide.
| Compound Name | N-[6-[heptanoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)heptanamide |
|---|---|
| PubChem CID | 18998994 |
| Molecular Formula | C38H74N4O2 |
| Molecular Weight | 619.04 g/mol |
| Exact Mass | 618.58 |
| IUPAC Name | N-[6-[heptanoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCCCCCN(C(=O)CCCCCC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C38H74N4O2/c1-11-13-15-19-23-33(43)41(31-27-35(3,4)39-36(5,6)28-31)25-21-17-18-22-26-42(34(44)24-20-16-14-12-2)32-29-37(7,8)40-38(9,10)30-32/h31-32,39-40H,11-30H2,1-10H3 |
| InChIKey | XCLYKCGHORMZOF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.04 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|