C28H54N4O4 — CID 11113943
methyl N-[6-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate (PubChem CID 11113943) has the molecular formula C28H54N4O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is methyl N-[6-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate.
| Compound Name | methyl N-[6-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 11113943 |
| Molecular Formula | C28H54N4O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | methyl N-[6-[methoxycarbonyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
| SMILES | COC(=O)N(CCCCCCN(C(=O)OC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C28H54N4O4/c1-25(2)17-21(18-26(3,4)29-25)31(23(33)35-9)15-13-11-12-14-16-32(24(34)36-10)22-19-27(5,6)30-28(7,8)20-22/h21-22,29-30H,11-20H2,1-10H3 |
| InChIKey | LJEYRILFGBAPOD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|