C36H70N4O4 — CID 19704404
propyl 3-[6-[(3-oxo-3-propoxypropyl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propanoate (PubChem CID 19704404) has the molecular formula C36H70N4O4 and a molecular weight of 622.98 g/mol. Its IUPAC name is propyl 3-[6-[(3-oxo-3-propoxypropyl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propanoate.
| Compound Name | propyl 3-[6-[(3-oxo-3-propoxypropyl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 19704404 |
| Molecular Formula | C36H70N4O4 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.54 |
| IUPAC Name | propyl 3-[6-[(3-oxo-3-propoxypropyl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propanoate |
| SMILES | CCCOC(=O)CCN(CCCCCCN(CCC(=O)OCCC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C36H70N4O4/c1-11-23-43-31(41)17-21-39(29-25-33(3,4)37-34(5,6)26-29)19-15-13-14-16-20-40(22-18-32(42)44-24-12-2)30-27-35(7,8)38-36(9,10)28-30/h29-30,37-38H,11-28H2,1-10H3 |
| InChIKey | HNIYHLSKPARSPB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|