C66H120N14O6 — CID 14746219
bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethyl] butanedioate (PubChem CID 14746219) has the molecular formula C66H120N14O6 and a molecular weight of 1205.78 g/mol. Its IUPAC name is bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethyl] butanedioate.
| Compound Name | bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethyl] butanedioate |
|---|---|
| PubChem CID | 14746219 |
| Molecular Formula | C66H120N14O6 |
| Molecular Weight | 1205.78 g/mol |
| Exact Mass | 1204.95 |
| IUPAC Name | bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethyl] butanedioate |
| SMILES | CCCCN(c1nc(OCCOC(=O)CCC(=O)OCCOc2nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)n2)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C66H120N14O6/c1-21-25-31-77(47-39-59(5,6)73-60(7,8)40-47)53-67-54(78(32-26-22-2)48-41-61(9,10)74-62(11,12)42-48)70-57(69-53)85-37-35-83-51(81)29-30-52(82)84-36-38-86-58-71-55(79(33-27-23-3)49-43-63(13,14)75-64(15,16)44-49)68-56(72-58)80(34-28-24-4)50-45-65(17,18)76-66(19,20)46-50/h47-50,73-76H,21-46H2,1-20H3 |
| InChIKey | REDVBSHEMVISOP-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 209.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.78 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|