C42H81N9 — CID 58038481
2-N,4-N-dibutyl-6-[[propyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 58038481) has the molecular formula C42H81N9 and a molecular weight of 712.17 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-[[propyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-6-[[propyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58038481 |
| Molecular Formula | C42H81N9 |
| Molecular Weight | 712.17 g/mol |
| Exact Mass | 711.66 |
| IUPAC Name | 2-N,4-N-dibutyl-6-[[propyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1nc(CN(CCC)C2CC(C)(C)NC(C)(C)C2)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C42H81N9/c1-16-19-22-50(32-26-39(8,9)47-40(10,11)27-32)35-43-34(30-49(21-18-3)31-24-37(4,5)46-38(6,7)25-31)44-36(45-35)51(23-20-17-2)33-28-41(12,13)48-42(14,15)29-33/h31-33,46-48H,16-30H2,1-15H3 |
| InChIKey | XOLRZGIPTAHNRB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.17 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |