C37H68N8 — CID 59247817
6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 59247817) has the molecular formula C37H68N8 and a molecular weight of 625.01 g/mol. Its IUPAC name is 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59247817 |
| Molecular Formula | C37H68N8 |
| Molecular Weight | 625.01 g/mol |
| Exact Mass | 624.56 |
| IUPAC Name | 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(NCC2CC3CCC2C3)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C37H68N8/c1-11-13-17-44(29-21-34(3,4)42-35(5,6)22-29)32-39-31(38-25-28-20-26-15-16-27(28)19-26)40-33(41-32)45(18-14-12-2)30-23-36(7,8)43-37(9,10)24-30/h26-30,42-43H,11-25H2,1-10H3,(H,38,39,40,41) |
| InChIKey | HSZYXCNYMWKYQC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.01 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |