C39H81N9 — CID 159566923
2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine;methane (PubChem CID 159566923) has the molecular formula C39H81N9 and a molecular weight of 676.14 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine;methane.
| Compound Name | 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine;methane |
|---|---|
| PubChem CID | 159566923 |
| Molecular Formula | C39H81N9 |
| Molecular Weight | 676.14 g/mol |
| Exact Mass | 675.66 |
| IUPAC Name | 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine;methane |
| SMILES | C.C.CCCCCCNCNc1nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C37H73N9.2CH4/c1-13-16-19-20-21-38-28-39-31-40-32(45(22-17-14-2)29-24-34(4,5)43-35(6,7)25-29)42-33(41-31)46(23-18-15-3)30-26-36(8,9)44(12)37(10,11)27-30;;/h29-30,38,43H,13-28H2,1-12H3,(H,39,40,41,42);2*1H4 |
| InChIKey | MHHWXZUWWYZIRO-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.14 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|