C39H72N8 — CID 59247816
6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 59247816) has the molecular formula C39H72N8 and a molecular weight of 653.06 g/mol. Its IUPAC name is 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59247816 |
| Molecular Formula | C39H72N8 |
| Molecular Weight | 653.06 g/mol |
| Exact Mass | 652.59 |
| IUPAC Name | 6-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(NCC2CC3CCC2C3)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C39H72N8/c1-13-15-19-46(31-23-36(3,4)44(11)37(5,6)24-31)34-41-33(40-27-30-22-28-17-18-29(30)21-28)42-35(43-34)47(20-16-14-2)32-25-38(7,8)45(12)39(9,10)26-32/h28-32H,13-27H2,1-12H3,(H,40,41,42,43) |
| InChIKey | NAAHOWLYRBXLTQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.06 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |