C38H75N9 — CID 58004437
2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 58004437) has the molecular formula C38H75N9 and a molecular weight of 658.08 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 58004437 |
| Molecular Formula | C38H75N9 |
| Molecular Weight | 658.08 g/mol |
| Exact Mass | 657.61 |
| IUPAC Name | 2-N,4-N-dibutyl-6-N-[(hexylamino)methyl]-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCNCNc1nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C38H75N9/c1-14-17-20-21-22-39-29-40-32-41-33(46(23-18-15-2)30-25-35(4,5)44(12)36(6,7)26-30)43-34(42-32)47(24-19-16-3)31-27-37(8,9)45(13)38(10,11)28-31/h30-31,39H,14-29H2,1-13H3,(H,40,41,42,43) |
| InChIKey | PCWZIDYOLURWOC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.08 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|