C30H59N9 — CID 138690349
6-N-[3-(ethylamino)propyl]-2-N,4-N-dimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 138690349) has the molecular formula C30H59N9 and a molecular weight of 545.87 g/mol. Its IUPAC name is 6-N-[3-(ethylamino)propyl]-2-N,4-N-dimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[3-(ethylamino)propyl]-2-N,4-N-dimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 138690349 |
| Molecular Formula | C30H59N9 |
| Molecular Weight | 545.87 g/mol |
| Exact Mass | 545.49 |
| IUPAC Name | 6-N-[3-(ethylamino)propyl]-2-N,4-N-dimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNCCCNc1nc(N(C)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C30H59N9/c1-14-31-16-15-17-32-24-33-25(36(10)22-18-27(2,3)38(12)28(4,5)19-22)35-26(34-24)37(11)23-20-29(6,7)39(13)30(8,9)21-23/h22-23,31H,14-21H2,1-13H3,(H,32,33,34,35) |
| InChIKey | TVTZFNCSPGKNBW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|