C33H64N8 — CID 59247834
2-N,4-N-dibutyl-6-N-ethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 59247834) has the molecular formula C33H64N8 and a molecular weight of 572.93 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-N-ethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibutyl-6-N-ethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59247834 |
| Molecular Formula | C33H64N8 |
| Molecular Weight | 572.93 g/mol |
| Exact Mass | 572.53 |
| IUPAC Name | 2-N,4-N-dibutyl-6-N-ethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(NCC)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C33H64N8/c1-14-17-19-40(25-21-30(4,5)38(12)31(6,7)22-25)28-35-27(34-16-3)36-29(37-28)41(20-18-15-2)26-23-32(8,9)39(13)33(10,11)24-26/h25-26H,14-24H2,1-13H3,(H,34,35,36,37) |
| InChIKey | JXCYBAFSXYCDIY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.93 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |