C33H62N8 — CID 143681738
6-N-cyclohexyl-2-N-hexyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 143681738) has the molecular formula C33H62N8 and a molecular weight of 570.92 g/mol. Its IUPAC name is 6-N-cyclohexyl-2-N-hexyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-cyclohexyl-2-N-hexyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 143681738 |
| Molecular Formula | C33H62N8 |
| Molecular Weight | 570.92 g/mol |
| Exact Mass | 570.51 |
| IUPAC Name | 6-N-cyclohexyl-2-N-hexyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCN(c1nc(NC2CCCCC2)nc(NC2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C33H62N8/c1-10-11-12-16-19-41(26-22-32(6,7)40-33(8,9)23-26)29-37-27(34-24-17-14-13-15-18-24)36-28(38-29)35-25-20-30(2,3)39-31(4,5)21-25/h24-26,39-40H,10-23H2,1-9H3,(H2,34,35,36,37,38) |
| InChIKey | KXTKUELSYJZWIK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.92 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|