C26H49N7O5 — CID 88526691
2-[[4-(cyclohexylamino)-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethoxy)amino]oxyethanol (PubChem CID 88526691) has the molecular formula C26H49N7O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is 2-[[4-(cyclohexylamino)-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethoxy)amino]oxyethanol.
| Compound Name | 2-[[4-(cyclohexylamino)-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethoxy)amino]oxyethanol |
|---|---|
| PubChem CID | 88526691 |
| Molecular Formula | C26H49N7O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.38 |
| IUPAC Name | 2-[[4-(cyclohexylamino)-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethoxy)amino]oxyethanol |
| SMILES | COCCCN(c1nc(NC2CCCCC2)nc(N(OCCO)OCCO)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H49N7O5/c1-25(2)18-21(19-26(3,4)31-25)32(12-9-15-36-5)23-28-22(27-20-10-7-6-8-11-20)29-24(30-23)33(37-16-13-34)38-17-14-35/h20-21,31,34-35H,6-19H2,1-5H3,(H,27,28,29,30) |
| InChIKey | LUGQWONUPJDRKL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|