C43H82N8 — CID 54065019
N'-[2-[4-(cyclohexylamino)-6-propyl-1,3,5-triazin-2-yl]ethyl]-N-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)octane-1,8-diamine (PubChem CID 54065019) has the molecular formula C43H82N8 and a molecular weight of 711.18 g/mol. Its IUPAC name is N'-[2-[4-(cyclohexylamino)-6-propyl-1,3,5-triazin-2-yl]ethyl]-N-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)octane-1,8-diamine.
| Compound Name | N'-[2-[4-(cyclohexylamino)-6-propyl-1,3,5-triazin-2-yl]ethyl]-N-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)octane-1,8-diamine |
|---|---|
| PubChem CID | 54065019 |
| Molecular Formula | C43H82N8 |
| Molecular Weight | 711.18 g/mol |
| Exact Mass | 710.67 |
| IUPAC Name | N'-[2-[4-(cyclohexylamino)-6-propyl-1,3,5-triazin-2-yl]ethyl]-N-propyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)octane-1,8-diamine |
| SMILES | CCCc1nc(CCN(CCCCCCCCN(CCC)C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C43H82N8/c1-11-22-37-45-38(47-39(46-37)44-34-23-18-17-19-24-34)25-29-51(36-32-42(7,8)49-43(9,10)33-36)28-21-16-14-13-15-20-27-50(26-12-2)35-30-40(3,4)48-41(5,6)31-35/h34-36,48-49H,11-33H2,1-10H3,(H,44,45,46,47) |
| InChIKey | MCIHYRQGGBMOJQ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.18 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|