C11H19N5 — CID 91621401
2-N-cyclohexyl-6-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 91621401) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-N-cyclohexyl-6-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-6-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91621401 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-N-cyclohexyl-6-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nc(N)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C11H19N5/c1-2-9-14-10(12)16-11(15-9)13-8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | PKKINVJGSFXVJD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |